C22H26F3NO3S — CID 123764339
N-[3-(cyclohexyloxymethyl)phenyl]-N-ethyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 123764339) has the molecular formula C22H26F3NO3S and a molecular weight of 441.52 g/mol. Its IUPAC name is N-[3-(cyclohexyloxymethyl)phenyl]-N-ethyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[3-(cyclohexyloxymethyl)phenyl]-N-ethyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 123764339 |
| Molecular Formula | C22H26F3NO3S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | N-[3-(cyclohexyloxymethyl)phenyl]-N-ethyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCN(c1cccc(COC2CCCCC2)c1)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H26F3NO3S/c1-2-26(30(27,28)21-13-7-9-18(15-21)22(23,24)25)19-10-6-8-17(14-19)16-29-20-11-4-3-5-12-20/h6-10,13-15,20H,2-5,11-12,16H2,1H3 |
| InChIKey | HNIHDBDYYJDEFY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |