C15H13BrF3NO2S — CID 123900424
N-(3-bromophenyl)-N-ethyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 123900424) has the molecular formula C15H13BrF3NO2S and a molecular weight of 408.24 g/mol. Its IUPAC name is N-(3-bromophenyl)-N-ethyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3-bromophenyl)-N-ethyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 123900424 |
| Molecular Formula | C15H13BrF3NO2S |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | N-(3-bromophenyl)-N-ethyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCN(c1cccc(Br)c1)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13BrF3NO2S/c1-2-20(13-7-4-6-12(16)10-13)23(21,22)14-8-3-5-11(9-14)15(17,18)19/h3-10H,2H2,1H3 |
| InChIKey | WDSCEIRRCVAHSI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |