C23H21ClF3NO3S — CID 130192949
N-[3-[1-(2-chlorophenoxy)ethyl]phenyl]-N-ethyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 130192949) has the molecular formula C23H21ClF3NO3S and a molecular weight of 483.94 g/mol. Its IUPAC name is N-[3-[1-(2-chlorophenoxy)ethyl]phenyl]-N-ethyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[3-[1-(2-chlorophenoxy)ethyl]phenyl]-N-ethyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 130192949 |
| Molecular Formula | C23H21ClF3NO3S |
| Molecular Weight | 483.94 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | N-[3-[1-(2-chlorophenoxy)ethyl]phenyl]-N-ethyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCN(c1cccc(C(C)Oc2ccccc2Cl)c1)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H21ClF3NO3S/c1-3-28(32(29,30)20-11-7-9-18(15-20)23(25,26)27)19-10-6-8-17(14-19)16(2)31-22-13-5-4-12-21(22)24/h4-16H,3H2,1-2H3 |
| InChIKey | MVLMKFDVWGEGFT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.94 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |