About (2,5-dihydroxypyrrol-1-yl) bicyclo[2.2.1]heptane-2-carboxylate
(2,5-dihydroxypyrrol-1-yl) bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 123766086) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) bicyclo[2.2.1]heptane-2-carboxylate.
Analyze (2,5-dihydroxypyrrol-1-yl) bicyclo[2.2.1]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) bicyclo[2.2.1]heptane-2-carboxylate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) bicyclo[2.2.1]heptane-2-carboxylate (CID 123766086) is (2,5-dihydroxypyrrol-1-yl) bicyclo[2.2.1]heptane-2-carboxylate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) bicyclo[2.2.1]heptane-2-carboxylate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) bicyclo[2.2.1]heptane-2-carboxylate is O=C(On1c(O)ccc1O)C1CC2CCC1C2.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) bicyclo[2.2.1]heptane-2-carboxylate?
The InChIKey is UBBHNRQFRKBYCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c14-10-3-4-11(15)13(10)17-12(16)9-6-7-1-2-8(9)5-7/h3-4,7-9,14-15H,1-2,5-6H2.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) bicyclo[2.2.1]heptane-2-carboxylate?
(2,5-dihydroxypyrrol-1-yl) bicyclo[2.2.1]heptane-2-carboxylate has a molecular weight of 237.25 g/mol, XLogP of 1.29, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) bicyclo[2.2.1]heptane-2-carboxylate is sourced from PubChem (CID 123766086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).