C25H23F3N2O2 — CID 123767797
1-methoxy-2-[4-[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]-1,4-dihydroisoquinolin-3-one (PubChem CID 123767797) has the molecular formula C25H23F3N2O2 and a molecular weight of 440.47 g/mol. Its IUPAC name is 1-methoxy-2-[4-[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]-1,4-dihydroisoquinolin-3-one.
| Compound Name | 1-methoxy-2-[4-[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]-1,4-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 123767797 |
| Molecular Formula | C25H23F3N2O2 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 1-methoxy-2-[4-[methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]phenyl]-1,4-dihydroisoquinolin-3-one |
| SMILES | COC1c2ccccc2CC(=O)N1c1ccc(N(C)Cc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C25H23F3N2O2/c1-29(16-17-7-9-19(10-8-17)25(26,27)28)20-11-13-21(14-12-20)30-23(31)15-18-5-3-4-6-22(18)24(30)32-2/h3-14,24H,15-16H2,1-2H3 |
| InChIKey | DWNGGPWPUKICED-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|