About 8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one
8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 123771981) has the molecular formula C9H12F3NO2
and a molecular weight of 223.19 g/mol. Its IUPAC name is 8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one.
Molecular Properties
| Compound Name | 8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one |
| PubChem CID | 123771981 |
| Molecular Formula | C9H12F3NO2 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | O=C1CC2CCC(C1)N2C(O)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO2/c10-9(11,12)8(15)13-5-1-2-6(13)4-7(14)3-5/h5-6,8,15H,1-4H2 |
| InChIKey | CBOJLUSIHVKNNL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one?
The IUPAC name of 8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one (CID 123771981) is 8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one.
What is the SMILES notation for 8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one?
The canonical SMILES for 8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one is O=C1CC2CCC(C1)N2C(O)C(F)(F)F.
What is the InChIKey of 8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one?
The InChIKey is CBOJLUSIHVKNNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NO2/c10-9(11,12)8(15)13-5-1-2-6(13)4-7(14)3-5/h5-6,8,15H,1-4H2.
What are the key properties of 8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one?
8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one has a molecular weight of 223.19 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,2,2-trifluoro-1-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-one is sourced from PubChem (CID 123771981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).