C25H27ClN8O3 — CID 123773818
1-(7-chloroquinolin-4-yl)-5-(2,6-dimethoxyphenyl)-N-[(1E)-1-hydrazinylidene-1-(2-methylhydrazinyl)propan-2-yl]pyrazole-3-carboxamide (PubChem CID 123773818) has the molecular formula C25H27ClN8O3 and a molecular weight of 523.00 g/mol. Its IUPAC name is 1-(7-chloroquinolin-4-yl)-5-(2,6-dimethoxyphenyl)-N-[(1E)-1-hydrazinylidene-1-(2-methylhydrazinyl)propan-2-yl]pyrazole-3-carboxamide.
| Compound Name | 1-(7-chloroquinolin-4-yl)-5-(2,6-dimethoxyphenyl)-N-[(1E)-1-hydrazinylidene-1-(2-methylhydrazinyl)propan-2-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 123773818 |
| Molecular Formula | C25H27ClN8O3 |
| Molecular Weight | 523.00 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 1-(7-chloroquinolin-4-yl)-5-(2,6-dimethoxyphenyl)-N-[(1E)-1-hydrazinylidene-1-(2-methylhydrazinyl)propan-2-yl]pyrazole-3-carboxamide |
| SMILES | CNN/C(=N/N)C(C)NC(=O)c1cc(-c2c(OC)cccc2OC)n(-c2ccnc3cc(Cl)ccc23)n1 |
| InChI | InChI=1S/C25H27ClN8O3/c1-14(24(31-27)32-28-2)30-25(35)18-13-20(23-21(36-3)6-5-7-22(23)37-4)34(33-18)19-10-11-29-17-12-15(26)8-9-16(17)19/h5-14,28H,27H2,1-4H3,(H,30,35)(H,31,32) |
| InChIKey | XUZHQPDBSTXLGE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 140.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.00 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|