C24H18N4O6 — CID 23364597
1-(2-amino-1,3-dioxobenzo[de]isoquinolin-6-yl)-5-(2,6-dimethoxyphenyl)pyrazole-3-carboxylic acid (PubChem CID 23364597) has the molecular formula C24H18N4O6 and a molecular weight of 458.43 g/mol. Its IUPAC name is 1-(2-amino-1,3-dioxobenzo[de]isoquinolin-6-yl)-5-(2,6-dimethoxyphenyl)pyrazole-3-carboxylic acid.
| Compound Name | 1-(2-amino-1,3-dioxobenzo[de]isoquinolin-6-yl)-5-(2,6-dimethoxyphenyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 23364597 |
| Molecular Formula | C24H18N4O6 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 1-(2-amino-1,3-dioxobenzo[de]isoquinolin-6-yl)-5-(2,6-dimethoxyphenyl)pyrazole-3-carboxylic acid |
| SMILES | COc1cccc(OC)c1-c1cc(C(=O)O)nn1-c1ccc2c3c(cccc13)C(=O)N(N)C2=O |
| InChI | InChI=1S/C24H18N4O6/c1-33-18-7-4-8-19(34-2)21(18)17-11-15(24(31)32)26-28(17)16-10-9-14-20-12(16)5-3-6-13(20)22(29)27(25)23(14)30/h3-11H,25H2,1-2H3,(H,31,32) |
| InChIKey | ZWDLMAFZVLIELQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|