C18H20O3S — CID 123774029
4-(4-but-2-en-2-yloxyphenyl)sulfonyl-1,2-dimethylbenzene (PubChem CID 123774029) has the molecular formula C18H20O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is 4-(4-but-2-en-2-yloxyphenyl)sulfonyl-1,2-dimethylbenzene.
| Compound Name | 4-(4-but-2-en-2-yloxyphenyl)sulfonyl-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 123774029 |
| Molecular Formula | C18H20O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 4-(4-but-2-en-2-yloxyphenyl)sulfonyl-1,2-dimethylbenzene |
| SMILES | CC=C(C)Oc1ccc(S(=O)(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C18H20O3S/c1-5-15(4)21-16-7-10-17(11-8-16)22(19,20)18-9-6-13(2)14(3)12-18/h5-12H,1-4H3 |
| InChIKey | KCUBLGGFBZUHQD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|