C21H23ClN4O3 — CID 123774836
4-[1-(6-chloro-3-methylimidazo[4,5-c]pyridin-4-yl)oxyethyl]-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 123774836) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is 4-[1-(6-chloro-3-methylimidazo[4,5-c]pyridin-4-yl)oxyethyl]-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 4-[1-(6-chloro-3-methylimidazo[4,5-c]pyridin-4-yl)oxyethyl]-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 123774836 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 4-[1-(6-chloro-3-methylimidazo[4,5-c]pyridin-4-yl)oxyethyl]-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(CN2CC(C(C)Oc3nc(Cl)cc4ncn(C)c34)CC2=O)cc1 |
| InChI | InChI=1S/C21H23ClN4O3/c1-13(29-21-20-17(9-18(22)24-21)23-12-25(20)2)15-8-19(27)26(11-15)10-14-4-6-16(28-3)7-5-14/h4-7,9,12-13,15H,8,10-11H2,1-3H3 |
| InChIKey | ZKWCQAFNLFJSHO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|