C24H28ClIN4O4S — CID 135157730
2-[[6-chloro-4-[(1R)-1-[(3R)-1-[(1R)-1-(4-methoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl]ethoxy]imidazo[4,5-c]pyridin-3-yl]methoxy]ethyl thiohypoiodite (PubChem CID 135157730) has the molecular formula C24H28ClIN4O4S and a molecular weight of 630.94 g/mol. Its IUPAC name is 2-[[6-chloro-4-[(1R)-1-[(3R)-1-[(1R)-1-(4-methoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl]ethoxy]imidazo[4,5-c]pyridin-3-yl]methoxy]ethyl thiohypoiodite.
| Compound Name | 2-[[6-chloro-4-[(1R)-1-[(3R)-1-[(1R)-1-(4-methoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl]ethoxy]imidazo[4,5-c]pyridin-3-yl]methoxy]ethyl thiohypoiodite |
|---|---|
| PubChem CID | 135157730 |
| Molecular Formula | C24H28ClIN4O4S |
| Molecular Weight | 630.94 g/mol |
| Exact Mass | 630.06 |
| IUPAC Name | 2-[[6-chloro-4-[(1R)-1-[(3R)-1-[(1R)-1-(4-methoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl]ethoxy]imidazo[4,5-c]pyridin-3-yl]methoxy]ethyl thiohypoiodite |
| SMILES | COc1ccc([C@@H](C)N2C[C@H]([C@@H](C)Oc3nc(Cl)cc4ncn(COCCSI)c34)CC2=O)cc1 |
| InChI | InChI=1S/C24H28ClIN4O4S/c1-15(17-4-6-19(32-3)7-5-17)30-12-18(10-22(30)31)16(2)34-24-23-20(11-21(25)28-24)27-13-29(23)14-33-8-9-35-26/h4-7,11,13,15-16,18H,8-10,12,14H2,1-3H3/t15-,16-,18-/m1/s1 |
| InChIKey | LJWJHRQTQNURLS-JFIYKMOQSA-N |
| XLogP | 5.53 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.94 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|