C30H40BN3O5 — CID 175132842
(4R)-4-[1-[2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-4-yl]oxyethyl]-1-[1-(4-methoxyphenyl)ethyl]pyrrolidin-2-one (PubChem CID 175132842) has the molecular formula C30H40BN3O5 and a molecular weight of 533.48 g/mol. Its IUPAC name is (4R)-4-[1-[2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-4-yl]oxyethyl]-1-[1-(4-methoxyphenyl)ethyl]pyrrolidin-2-one.
| Compound Name | (4R)-4-[1-[2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-4-yl]oxyethyl]-1-[1-(4-methoxyphenyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 175132842 |
| Molecular Formula | C30H40BN3O5 |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | (4R)-4-[1-[2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-4-yl]oxyethyl]-1-[1-(4-methoxyphenyl)ethyl]pyrrolidin-2-one |
| SMILES | COc1ccc(C(C)N2C[C@H](C(C)Oc3cc(B4OC(C)(C)C(C)(C)O4)cc4nn(C)c(C)c34)CC2=O)cc1 |
| InChI | InChI=1S/C30H40BN3O5/c1-18(21-10-12-24(36-9)13-11-21)34-17-22(14-27(34)35)20(3)37-26-16-23(15-25-28(26)19(2)33(8)32-25)31-38-29(4,5)30(6,7)39-31/h10-13,15-16,18,20,22H,14,17H2,1-9H3/t18?,20?,22-/m1/s1 |
| InChIKey | IGGFRIPLWBTHOX-ZOGYUUGASA-N |
| XLogP | 4.57 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|