About 4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid
4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid (PubChem CID 123774854) has the molecular formula C15H25NO5
and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | 4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid |
| PubChem CID | 123774854 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid |
| SMILES | CC(C)(CC(C)(C)N1CCOCC1)OC(=O)C=CC(=O)O |
| InChI | InChI=1S/C15H25NO5/c1-14(2,16-7-9-20-10-8-16)11-15(3,4)21-13(19)6-5-12(17)18/h5-6H,7-11H2,1-4H3,(H,17,18) |
| InChIKey | OIXGJHWCRZCARM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid?
The IUPAC name of 4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid (CID 123774854) is 4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid.
What is the SMILES notation for 4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid?
The canonical SMILES for 4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid is CC(C)(CC(C)(C)N1CCOCC1)OC(=O)C=CC(=O)O.
What is the InChIKey of 4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid?
The InChIKey is OIXGJHWCRZCARM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO5/c1-14(2,16-7-9-20-10-8-16)11-15(3,4)21-13(19)6-5-12(17)18/h5-6H,7-11H2,1-4H3,(H,17,18).
What are the key properties of 4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid?
4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid has a molecular weight of 299.37 g/mol, XLogP of 1.45, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethyl-4-morpholin-4-ylpentan-2-yl)oxy-4-oxobut-2-enoic acid is sourced from PubChem (CID 123774854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).