C14H32N2OS — CID 153374624
4-(2,4,4,5-tetramethylhexan-2-yl)morpholine;thiohydroxylamine (PubChem CID 153374624) has the molecular formula C14H32N2OS and a molecular weight of 276.49 g/mol. Its IUPAC name is 4-(2,4,4,5-tetramethylhexan-2-yl)morpholine;thiohydroxylamine.
| Compound Name | 4-(2,4,4,5-tetramethylhexan-2-yl)morpholine;thiohydroxylamine |
|---|---|
| PubChem CID | 153374624 |
| Molecular Formula | C14H32N2OS |
| Molecular Weight | 276.49 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 4-(2,4,4,5-tetramethylhexan-2-yl)morpholine;thiohydroxylamine |
| SMILES | CC(C)C(C)(C)CC(C)(C)N1CCOCC1.NS |
| InChI | InChI=1S/C14H29NO.H3NS/c1-12(2)13(3,4)11-14(5,6)15-7-9-16-10-8-15;1-2/h12H,7-11H2,1-6H3;2H,1H2 |
| InChIKey | BNWMQSAHSZBPPO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|