C9H11NO — CID 123775196
3,4a,5,6-tetrahydro-2H-quinolin-4-one (PubChem CID 123775196) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 3,4a,5,6-tetrahydro-2H-quinolin-4-one.
| Compound Name | 3,4a,5,6-tetrahydro-2H-quinolin-4-one |
|---|---|
| PubChem CID | 123775196 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 3,4a,5,6-tetrahydro-2H-quinolin-4-one |
| SMILES | O=C1CCN=C2C=CCCC12 |
| InChI | InChI=1S/C9H11NO/c11-9-5-6-10-8-4-2-1-3-7(8)9/h2,4,7H,1,3,5-6H2 |
| InChIKey | AWBBYTYNRDYACE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |