C14H35N4+ — CID 123775918
2-[2-[2-(dimethylamino)ethyl-methylamino]ethyl-methylamino]ethyl-ethyl-dimethylazanium (PubChem CID 123775918) has the molecular formula C14H35N4+ and a molecular weight of 259.46 g/mol. Its IUPAC name is 2-[2-[2-(dimethylamino)ethyl-methylamino]ethyl-methylamino]ethyl-ethyl-dimethylazanium.
| Compound Name | 2-[2-[2-(dimethylamino)ethyl-methylamino]ethyl-methylamino]ethyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 123775918 |
| Molecular Formula | C14H35N4+ |
| Molecular Weight | 259.46 g/mol |
| Exact Mass | 259.29 |
| IUPAC Name | 2-[2-[2-(dimethylamino)ethyl-methylamino]ethyl-methylamino]ethyl-ethyl-dimethylazanium |
| SMILES | CC[N+](C)(C)CCN(C)CCN(C)CCN(C)C |
| InChI | InChI=1S/C14H35N4/c1-8-18(6,7)14-13-17(5)12-11-16(4)10-9-15(2)3/h8-14H2,1-7H3/q+1 |
| InChIKey | HIOQWKVOGLXABZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.46 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|