C11H25F3N2O2 — CID 159986541
2-(dimethylamino)ethyl-ethyl-dimethylazanium;methane;2,2,2-trifluoroacetate (PubChem CID 159986541) has the molecular formula C11H25F3N2O2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl-ethyl-dimethylazanium;methane;2,2,2-trifluoroacetate.
| Compound Name | 2-(dimethylamino)ethyl-ethyl-dimethylazanium;methane;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 159986541 |
| Molecular Formula | C11H25F3N2O2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 2-(dimethylamino)ethyl-ethyl-dimethylazanium;methane;2,2,2-trifluoroacetate |
| SMILES | C.CC[N+](C)(C)CCN(C)C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C8H21N2.C2HF3O2.CH4/c1-6-10(4,5)8-7-9(2)3;3-2(4,5)1(6)7;/h6-8H2,1-5H3;(H,6,7);1H4/q+1;;/p-1 |
| InChIKey | GMPXXIQYQXWGHG-UHFFFAOYSA-M |
| XLogP | 0.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|