C8H23NSi2 — CID 123777896
N-(disilanyl)-2-methyl-N-(2-methylpropyl)propan-1-amine (PubChem CID 123777896) has the molecular formula C8H23NSi2 and a molecular weight of 189.45 g/mol. Its IUPAC name is N-(disilanyl)-2-methyl-N-(2-methylpropyl)propan-1-amine.
| Compound Name | N-(disilanyl)-2-methyl-N-(2-methylpropyl)propan-1-amine |
|---|---|
| PubChem CID | 123777896 |
| Molecular Formula | C8H23NSi2 |
| Molecular Weight | 189.45 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | N-(disilanyl)-2-methyl-N-(2-methylpropyl)propan-1-amine |
| SMILES | CC(C)CN(CC(C)C)[SiH2][SiH3] |
| InChI | InChI=1S/C8H23NSi2/c1-7(2)5-9(11-10)6-8(3)4/h7-8H,5-6,11H2,1-4,10H3 |
| InChIKey | MIKZFCVLZFFQNR-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.45 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|