C11H10F3NO2 — CID 123781895
4,4,4-trifluoro-2-[(2-methyl-4-pyridinyl)methylidene]butanoic acid (PubChem CID 123781895) has the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. Its IUPAC name is 4,4,4-trifluoro-2-[(2-methyl-4-pyridinyl)methylidene]butanoic acid.
| Compound Name | 4,4,4-trifluoro-2-[(2-methyl-4-pyridinyl)methylidene]butanoic acid |
|---|---|
| PubChem CID | 123781895 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 4,4,4-trifluoro-2-[(2-methyl-4-pyridinyl)methylidene]butanoic acid |
| SMILES | Cc1cc(C=C(CC(F)(F)F)C(=O)O)ccn1 |
| InChI | InChI=1S/C11H10F3NO2/c1-7-4-8(2-3-15-7)5-9(10(16)17)6-11(12,13)14/h2-5H,6H2,1H3,(H,16,17) |
| InChIKey | RIUQWUMIXDDWDG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|