C10H8F3NO2 — CID 170483926
4-[2-(trifluoromethyl)-4-pyridinyl]but-3-enoic acid (PubChem CID 170483926) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is 4-[2-(trifluoromethyl)-4-pyridinyl]but-3-enoic acid.
| Compound Name | 4-[2-(trifluoromethyl)-4-pyridinyl]but-3-enoic acid |
|---|---|
| PubChem CID | 170483926 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-[2-(trifluoromethyl)-4-pyridinyl]but-3-enoic acid |
| SMILES | O=C(O)CC=Cc1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F3NO2/c11-10(12,13)8-6-7(4-5-14-8)2-1-3-9(15)16/h1-2,4-6H,3H2,(H,15,16) |
| InChIKey | CGZHVCAEDJLPTG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |