C10H8FNO4 — CID 170483944
2-(3-carboxyprop-1-enyl)-3-fluoropyridine-4-carboxylic acid (PubChem CID 170483944) has the molecular formula C10H8FNO4 and a molecular weight of 225.18 g/mol. Its IUPAC name is 2-(3-carboxyprop-1-enyl)-3-fluoropyridine-4-carboxylic acid.
| Compound Name | 2-(3-carboxyprop-1-enyl)-3-fluoropyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 170483944 |
| Molecular Formula | C10H8FNO4 |
| Molecular Weight | 225.18 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2-(3-carboxyprop-1-enyl)-3-fluoropyridine-4-carboxylic acid |
| SMILES | O=C(O)CC=Cc1nccc(C(=O)O)c1F |
| InChI | InChI=1S/C10H8FNO4/c11-9-6(10(15)16)4-5-12-7(9)2-1-3-8(13)14/h1-2,4-5H,3H2,(H,13,14)(H,15,16) |
| InChIKey | PRSHARUYRVLYEA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |