4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide

C11H13NO2 — CID 157450822

IUPAC4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide
SMILESCC/C=C\c1ccnc(C)c1.O=C=O
InChIInChI=1S/C10H13N.CO2/c1-3-4-5-10-6-7-11-9(2)8-10;2-1-3/h4-8H,3H2,1-2H3;/b5-4-;
InChIKeyBSTYHUCXPACGLV-MKWAYWHRSA-N
MW191.23 g/mol
LogP2.23
Rot. Bonds2

About 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide

4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide (PubChem CID 157450822) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide.

Molecular Properties

Compound Name4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide
PubChem CID157450822
Molecular FormulaC11H13NO2
Molecular Weight191.23 g/mol
Exact Mass191.09
IUPAC Name4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide
SMILESCC/C=C\c1ccnc(C)c1.O=C=O
InChIInChI=1S/C10H13N.CO2/c1-3-4-5-10-6-7-11-9(2)8-10;2-1-3/h4-8H,3H2,1-2H3;/b5-4-;
InChIKeyBSTYHUCXPACGLV-MKWAYWHRSA-N
XLogP2.23
TPSA47.03 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.23
LogP ≤ 52.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide?
The IUPAC name of 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide (CID 157450822) is 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide.
What is the SMILES notation for 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide?
The canonical SMILES for 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide is CC/C=C\c1ccnc(C)c1.O=C=O.
What is the InChIKey of 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide?
The InChIKey is BSTYHUCXPACGLV-MKWAYWHRSA-N. The full InChI is InChI=1S/C10H13N.CO2/c1-3-4-5-10-6-7-11-9(2)8-10;2-1-3/h4-8H,3H2,1-2H3;/b5-4-;.
What are the key properties of 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide?
4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide has a molecular weight of 191.23 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide is sourced from PubChem (CID 157450822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).