About 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide
4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide (PubChem CID 157450822) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide.
Molecular Properties
| Compound Name | 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide |
| PubChem CID | 157450822 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide |
| SMILES | CC/C=C\c1ccnc(C)c1.O=C=O |
| InChI | InChI=1S/C10H13N.CO2/c1-3-4-5-10-6-7-11-9(2)8-10;2-1-3/h4-8H,3H2,1-2H3;/b5-4-; |
| InChIKey | BSTYHUCXPACGLV-MKWAYWHRSA-N |
| XLogP | 2.23 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide?
The IUPAC name of 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide (CID 157450822) is 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide.
What is the SMILES notation for 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide?
The canonical SMILES for 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide is CC/C=C\c1ccnc(C)c1.O=C=O.
What is the InChIKey of 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide?
The InChIKey is BSTYHUCXPACGLV-MKWAYWHRSA-N. The full InChI is InChI=1S/C10H13N.CO2/c1-3-4-5-10-6-7-11-9(2)8-10;2-1-3/h4-8H,3H2,1-2H3;/b5-4-;.
What are the key properties of 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide?
4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide has a molecular weight of 191.23 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-but-1-enyl]-2-methylpyridine;carbon dioxide is sourced from PubChem (CID 157450822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).