C32H43N7O2 — CID 123781939
3-[4-(1-cyclopentylpiperidin-4-yl)anilino]-5-[1-(cyclopropanecarbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]pyrazine-2-carboxamide (PubChem CID 123781939) has the molecular formula C32H43N7O2 and a molecular weight of 557.74 g/mol. Its IUPAC name is 3-[4-(1-cyclopentylpiperidin-4-yl)anilino]-5-[1-(cyclopropanecarbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]pyrazine-2-carboxamide.
| Compound Name | 3-[4-(1-cyclopentylpiperidin-4-yl)anilino]-5-[1-(cyclopropanecarbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123781939 |
| Molecular Formula | C32H43N7O2 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.35 |
| IUPAC Name | 3-[4-(1-cyclopentylpiperidin-4-yl)anilino]-5-[1-(cyclopropanecarbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]pyrazine-2-carboxamide |
| SMILES | NC(=O)c1ncc(N2CCCC3C2CCN3C(=O)C2CC2)nc1Nc1ccc(C2CCN(C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C32H43N7O2/c33-30(40)29-31(35-24-11-9-21(10-12-24)22-13-17-37(18-14-22)25-4-1-2-5-25)36-28(20-34-29)38-16-3-6-26-27(38)15-19-39(26)32(41)23-7-8-23/h9-12,20,22-23,25-27H,1-8,13-19H2,(H2,33,40)(H,35,36) |
| InChIKey | ATUMYQDCTGAFQY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |