C33H47N7O3 — CID 118114742
tert-butyl 4-[5-carbamoyl-6-[4-(1-cyclopentylpiperidin-4-yl)anilino]pyrazin-2-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxylate (PubChem CID 118114742) has the molecular formula C33H47N7O3 and a molecular weight of 589.79 g/mol. Its IUPAC name is tert-butyl 4-[5-carbamoyl-6-[4-(1-cyclopentylpiperidin-4-yl)anilino]pyrazin-2-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-carbamoyl-6-[4-(1-cyclopentylpiperidin-4-yl)anilino]pyrazin-2-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 118114742 |
| Molecular Formula | C33H47N7O3 |
| Molecular Weight | 589.79 g/mol |
| Exact Mass | 589.37 |
| IUPAC Name | tert-butyl 4-[5-carbamoyl-6-[4-(1-cyclopentylpiperidin-4-yl)anilino]pyrazin-2-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2C1CCCN2c1cnc(C(N)=O)c(Nc2ccc(C3CCN(C4CCCC4)CC3)cc2)n1 |
| InChI | InChI=1S/C33H47N7O3/c1-33(2,3)43-32(42)40-20-16-27-26(40)9-6-17-39(27)28-21-35-29(30(34)41)31(37-28)36-24-12-10-22(11-13-24)23-14-18-38(19-15-23)25-7-4-5-8-25/h10-13,21,23,25-27H,4-9,14-20H2,1-3H3,(H2,34,41)(H,36,37) |
| InChIKey | RQOUEKWRKZQVRU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.79 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |