C38H53N7O2 — CID 129156462
tert-butyl (3aR,7aR)-4-[5-cyano-6-[4-(1-cyclopentylpiperidin-4-yl)anilino]pyrazin-2-yl]-6-cyclopentyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxylate (PubChem CID 129156462) has the molecular formula C38H53N7O2 and a molecular weight of 639.89 g/mol. Its IUPAC name is tert-butyl (3aR,7aR)-4-[5-cyano-6-[4-(1-cyclopentylpiperidin-4-yl)anilino]pyrazin-2-yl]-6-cyclopentyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl (3aR,7aR)-4-[5-cyano-6-[4-(1-cyclopentylpiperidin-4-yl)anilino]pyrazin-2-yl]-6-cyclopentyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 129156462 |
| Molecular Formula | C38H53N7O2 |
| Molecular Weight | 639.89 g/mol |
| Exact Mass | 639.43 |
| IUPAC Name | tert-butyl (3aR,7aR)-4-[5-cyano-6-[4-(1-cyclopentylpiperidin-4-yl)anilino]pyrazin-2-yl]-6-cyclopentyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2[C@H]1CC(C1CCCC1)CN2c1cnc(C#N)c(Nc2ccc(C3CCN(C4CCCC4)CC3)cc2)n1 |
| InChI | InChI=1S/C38H53N7O2/c1-38(2,3)47-37(46)44-21-18-33-34(44)22-29(26-8-4-5-9-26)25-45(33)35-24-40-32(23-39)36(42-35)41-30-14-12-27(13-15-30)28-16-19-43(20-17-28)31-10-6-7-11-31/h12-15,24,26,28-29,31,33-34H,4-11,16-22,25H2,1-3H3,(H,41,42)/t29?,33-,34-/m1/s1 |
| InChIKey | VTYOLHYMYAKAMI-AZJHRQGWSA-N |
| XLogP | 7.61 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.89 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |