C33H45N7O2 — CID 118115456
tert-butyl (3aR,7aR)-4-[5-cyano-6-[4-(1-cyclopentylpiperidin-4-yl)anilino]pyrazin-2-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxylate (PubChem CID 118115456) has the molecular formula C33H45N7O2 and a molecular weight of 571.77 g/mol. Its IUPAC name is tert-butyl (3aR,7aR)-4-[5-cyano-6-[4-(1-cyclopentylpiperidin-4-yl)anilino]pyrazin-2-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl (3aR,7aR)-4-[5-cyano-6-[4-(1-cyclopentylpiperidin-4-yl)anilino]pyrazin-2-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 118115456 |
| Molecular Formula | C33H45N7O2 |
| Molecular Weight | 571.77 g/mol |
| Exact Mass | 571.36 |
| IUPAC Name | tert-butyl (3aR,7aR)-4-[5-cyano-6-[4-(1-cyclopentylpiperidin-4-yl)anilino]pyrazin-2-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2[C@H]1CCCN2c1cnc(C#N)c(Nc2ccc(C3CCN(C4CCCC4)CC3)cc2)n1 |
| InChI | InChI=1S/C33H45N7O2/c1-33(2,3)42-32(41)40-20-16-29-28(40)9-6-17-39(29)30-22-35-27(21-34)31(37-30)36-25-12-10-23(11-13-25)24-14-18-38(19-15-24)26-7-4-5-8-26/h10-13,22,24,26,28-29H,4-9,14-20H2,1-3H3,(H,36,37)/t28-,29-/m1/s1 |
| InChIKey | HPTIHKIFXIQMTA-FQLXRVMXSA-N |
| XLogP | 6.19 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.77 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |