C10H10 — CID 123782041
tetracyclo[4.3.1.01,7.02,5]deca-2(5),3-diene (PubChem CID 123782041) has the molecular formula C10H10 and a molecular weight of 130.19 g/mol. Its IUPAC name is tetracyclo[4.3.1.01,7.02,5]deca-2(5),3-diene.
| Compound Name | tetracyclo[4.3.1.01,7.02,5]deca-2(5),3-diene |
|---|---|
| PubChem CID | 123782041 |
| Molecular Formula | C10H10 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | tetracyclo[4.3.1.01,7.02,5]deca-2(5),3-diene |
| SMILES | C1=CC2=C1C1CC23CCC13 |
| InChI | InChI=1S/C10H10/c1-2-8-6(1)7-5-10(8)4-3-9(7)10/h1-2,7,9H,3-5H2 |
| InChIKey | NTPGATBIRXDRGO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |