C24H19F4N5O — CID 123783316
(7R)-7-fluoro-3-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-7-(3,4,5-trifluorophenyl)-5,6-dihydropyrrolo[2,1-c][1,2,4]triazole (PubChem CID 123783316) has the molecular formula C24H19F4N5O and a molecular weight of 469.44 g/mol. Its IUPAC name is (7R)-7-fluoro-3-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-7-(3,4,5-trifluorophenyl)-5,6-dihydropyrrolo[2,1-c][1,2,4]triazole.
| Compound Name | (7R)-7-fluoro-3-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-7-(3,4,5-trifluorophenyl)-5,6-dihydropyrrolo[2,1-c][1,2,4]triazole |
|---|---|
| PubChem CID | 123783316 |
| Molecular Formula | C24H19F4N5O |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (7R)-7-fluoro-3-[2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-7-(3,4,5-trifluorophenyl)-5,6-dihydropyrrolo[2,1-c][1,2,4]triazole |
| SMILES | COc1cc(C=Cc2nnc3n2CC[C@@]3(F)c2cc(F)c(F)c(F)c2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H19F4N5O/c1-14-12-32(13-29-14)19-5-3-15(9-20(19)34-2)4-6-21-30-31-23-24(28,7-8-33(21)23)16-10-17(25)22(27)18(26)11-16/h3-6,9-13H,7-8H2,1-2H3/t24-/m1/s1 |
| InChIKey | ZDPLFNKLYHQPQE-XMMPIXPASA-N |
| XLogP | 4.99 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|