C26H27F3N4O2 — CID 143996418
6-cyclopropyl-3-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-4-methyl-5,6-dihydro-1,2,4-oxadiazine;1,2,3-trifluorobenzene (PubChem CID 143996418) has the molecular formula C26H27F3N4O2 and a molecular weight of 484.52 g/mol. Its IUPAC name is 6-cyclopropyl-3-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-4-methyl-5,6-dihydro-1,2,4-oxadiazine;1,2,3-trifluorobenzene.
| Compound Name | 6-cyclopropyl-3-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-4-methyl-5,6-dihydro-1,2,4-oxadiazine;1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 143996418 |
| Molecular Formula | C26H27F3N4O2 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 6-cyclopropyl-3-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-4-methyl-5,6-dihydro-1,2,4-oxadiazine;1,2,3-trifluorobenzene |
| SMILES | COc1cc(/C=C/C2=NOC(C3CC3)CN2C)ccc1-n1cnc(C)c1.Fc1cccc(F)c1F |
| InChI | InChI=1S/C20H24N4O2.C6H3F3/c1-14-11-24(13-21-14)17-8-4-15(10-18(17)25-3)5-9-20-22-26-19(12-23(20)2)16-6-7-16;7-4-2-1-3-5(8)6(4)9/h4-5,8-11,13,16,19H,6-7,12H2,1-3H3;1-3H/b9-5+; |
| InChIKey | LWQAUKBNLCAQON-SZKNIZGXSA-N |
| XLogP | 5.36 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|