C19H18BrN7O — CID 123785140
2-[2-[5-bromo-2-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]ethenyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 123785140) has the molecular formula C19H18BrN7O and a molecular weight of 440.31 g/mol. Its IUPAC name is 2-[2-[5-bromo-2-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]ethenyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine.
| Compound Name | 2-[2-[5-bromo-2-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]ethenyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 123785140 |
| Molecular Formula | C19H18BrN7O |
| Molecular Weight | 440.31 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-[2-[5-bromo-2-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]ethenyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine |
| SMILES | COc1ccc(Cn2nc(Br)nc2C=Cc2nc3c(C)ncc(C)n3n2)cc1 |
| InChI | InChI=1S/C19H18BrN7O/c1-12-10-21-13(2)18-22-16(24-27(12)18)8-9-17-23-19(20)25-26(17)11-14-4-6-15(28-3)7-5-14/h4-10H,11H2,1-3H3 |
| InChIKey | HJPZXRWVAVHUTH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |