C13H13F2NO2 — CID 123785354
4-(4,4-difluorobutyl)-7-hydroxy-1H-quinolin-2-one (PubChem CID 123785354) has the molecular formula C13H13F2NO2 and a molecular weight of 253.25 g/mol. Its IUPAC name is 4-(4,4-difluorobutyl)-7-hydroxy-1H-quinolin-2-one.
| Compound Name | 4-(4,4-difluorobutyl)-7-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 123785354 |
| Molecular Formula | C13H13F2NO2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-(4,4-difluorobutyl)-7-hydroxy-1H-quinolin-2-one |
| SMILES | O=c1cc(CCCC(F)F)c2ccc(O)cc2[nH]1 |
| InChI | InChI=1S/C13H13F2NO2/c14-12(15)3-1-2-8-6-13(18)16-11-7-9(17)4-5-10(8)11/h4-7,12,17H,1-3H2,(H,16,18) |
| InChIKey | YGPNZGWSOZWSLJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |