C21H31NO4 — CID 139718292
4-butoxy-7-hydroxy-3-octoxy-1H-quinolin-2-one (PubChem CID 139718292) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is 4-butoxy-7-hydroxy-3-octoxy-1H-quinolin-2-one.
| Compound Name | 4-butoxy-7-hydroxy-3-octoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 139718292 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 4-butoxy-7-hydroxy-3-octoxy-1H-quinolin-2-one |
| SMILES | CCCCCCCCOc1c(OCCCC)c2ccc(O)cc2[nH]c1=O |
| InChI | InChI=1S/C21H31NO4/c1-3-5-7-8-9-10-14-26-20-19(25-13-6-4-2)17-12-11-16(23)15-18(17)22-21(20)24/h11-12,15,23H,3-10,13-14H2,1-2H3,(H,22,24) |
| InChIKey | OAKYFVFDYRGPJY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|