C27H33N5O4 — CID 123785502
diethyl 8,16-dimethyl-8,16,22,23,24-pentazatetracyclo[16.3.1.12,6.110,14]tetracosa-1(22),2,4,6(24),10(23),11,13,19-octaene-11,13-dicarboxylate (PubChem CID 123785502) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is diethyl 8,16-dimethyl-8,16,22,23,24-pentazatetracyclo[16.3.1.12,6.110,14]tetracosa-1(22),2,4,6(24),10(23),11,13,19-octaene-11,13-dicarboxylate.
| Compound Name | diethyl 8,16-dimethyl-8,16,22,23,24-pentazatetracyclo[16.3.1.12,6.110,14]tetracosa-1(22),2,4,6(24),10(23),11,13,19-octaene-11,13-dicarboxylate |
|---|---|
| PubChem CID | 123785502 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | diethyl 8,16-dimethyl-8,16,22,23,24-pentazatetracyclo[16.3.1.12,6.110,14]tetracosa-1(22),2,4,6(24),10(23),11,13,19-octaene-11,13-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)c2nc1CN(C)Cc1cccc(n1)C1=NC(C=CC1)CN(C)C2 |
| InChI | InChI=1S/C27H33N5O4/c1-5-35-26(33)20-13-21(27(34)36-6-2)25-17-32(4)15-19-10-8-12-23(29-19)22-11-7-9-18(28-22)14-31(3)16-24(20)30-25/h7-11,13,19H,5-6,12,14-17H2,1-4H3 |
| InChIKey | LQLVKEHTFIIMGQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 97.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|