C22H24FNO2 — CID 123788017
2-[ethenyl-[1-[2-(4-fluorophenyl)phenyl]ethyl]amino]hex-2-enoic acid (PubChem CID 123788017) has the molecular formula C22H24FNO2 and a molecular weight of 353.44 g/mol. Its IUPAC name is 2-[ethenyl-[1-[2-(4-fluorophenyl)phenyl]ethyl]amino]hex-2-enoic acid.
| Compound Name | 2-[ethenyl-[1-[2-(4-fluorophenyl)phenyl]ethyl]amino]hex-2-enoic acid |
|---|---|
| PubChem CID | 123788017 |
| Molecular Formula | C22H24FNO2 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 2-[ethenyl-[1-[2-(4-fluorophenyl)phenyl]ethyl]amino]hex-2-enoic acid |
| SMILES | C=CN(C(=CCCC)C(=O)O)C(C)c1ccccc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FNO2/c1-4-6-11-21(22(25)26)24(5-2)16(3)19-9-7-8-10-20(19)17-12-14-18(23)15-13-17/h5,7-16H,2,4,6H2,1,3H3,(H,25,26) |
| InChIKey | IDPVVCJBHHDEFV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|