C11H14BrN — CID 123788081
N-(5-bromo-3-methylhepta-1,3,5-trien-2-yl)prop-2-en-1-imine (PubChem CID 123788081) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is N-(5-bromo-3-methylhepta-1,3,5-trien-2-yl)prop-2-en-1-imine.
| Compound Name | N-(5-bromo-3-methylhepta-1,3,5-trien-2-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 123788081 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | N-(5-bromo-3-methylhepta-1,3,5-trien-2-yl)prop-2-en-1-imine |
| SMILES | C=C/C=N/C(=C)C(C)=CC(Br)=CC |
| InChI | InChI=1S/C11H14BrN/c1-5-7-13-10(4)9(3)8-11(12)6-2/h5-8H,1,4H2,2-3H3/b9-8?,11-6?,13-7+ |
| InChIKey | PMEDGYHZLDOQAA-CKKHMMIWSA-N |
| XLogP | 4.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|