methyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate

C18H18N2O3 — CID 123789390

IUPACmethyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate
SMILESCCc1c(COc2ccccc2C(=O)OC)nc2ccccn12
InChIInChI=1S/C18H18N2O3/c1-3-15-14(19-17-10-6-7-11-20(15)17)12-23-16-9-5-4-8-13(16)18(21)22-2/h4-11H,3,12H2,1-2H3
InChIKeyWRALCPRNJANCLY-UHFFFAOYSA-N
MW310.35 g/mol
LogP3.26
Rot. Bonds5

About methyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate

methyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate (PubChem CID 123789390) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is methyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate.

Molecular Properties

Compound Namemethyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate
PubChem CID123789390
Molecular FormulaC18H18N2O3
Molecular Weight310.35 g/mol
Exact Mass310.13
IUPAC Namemethyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate
SMILESCCc1c(COc2ccccc2C(=O)OC)nc2ccccn12
InChIInChI=1S/C18H18N2O3/c1-3-15-14(19-17-10-6-7-11-20(15)17)12-23-16-9-5-4-8-13(16)18(21)22-2/h4-11H,3,12H2,1-2H3
InChIKeyWRALCPRNJANCLY-UHFFFAOYSA-N
XLogP3.26
TPSA52.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.35
LogP ≤ 53.26
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate?
The IUPAC name of methyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate (CID 123789390) is methyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate.
What is the SMILES notation for methyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate?
The canonical SMILES for methyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate is CCc1c(COc2ccccc2C(=O)OC)nc2ccccn12.
What is the InChIKey of methyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate?
The InChIKey is WRALCPRNJANCLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O3/c1-3-15-14(19-17-10-6-7-11-20(15)17)12-23-16-9-5-4-8-13(16)18(21)22-2/h4-11H,3,12H2,1-2H3.
What are the key properties of methyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate?
methyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate has a molecular weight of 310.35 g/mol, XLogP of 3.26, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3-ethylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoate is sourced from PubChem (CID 123789390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).