C25H17F3N2O3 — CID 73051808
methyl 2-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methoxy]benzoate (PubChem CID 73051808) has the molecular formula C25H17F3N2O3 and a molecular weight of 450.42 g/mol. Its IUPAC name is methyl 2-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methoxy]benzoate.
| Compound Name | methyl 2-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 73051808 |
| Molecular Formula | C25H17F3N2O3 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | methyl 2-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccccc1OCc1nc2ccccn2c1C#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H17F3N2O3/c1-32-24(31)19-9-2-3-10-22(19)33-16-20-21(30-14-5-4-11-23(30)29-20)13-12-17-7-6-8-18(15-17)25(26,27)28/h2-11,14-15H,16H2,1H3 |
| InChIKey | HYVFOEGQQJSEAY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|