C22H20F3N3O2 — CID 140729297
ethyl 2-[1-[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]ethylamino]acetate (PubChem CID 140729297) has the molecular formula C22H20F3N3O2 and a molecular weight of 415.42 g/mol. Its IUPAC name is ethyl 2-[1-[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]ethylamino]acetate.
| Compound Name | ethyl 2-[1-[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]ethylamino]acetate |
|---|---|
| PubChem CID | 140729297 |
| Molecular Formula | C22H20F3N3O2 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | ethyl 2-[1-[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]ethylamino]acetate |
| SMILES | CCOC(=O)CNC(C)c1nc2ccccn2c1C#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F3N3O2/c1-3-30-20(29)14-26-15(2)21-18(28-12-5-4-9-19(28)27-21)11-10-16-7-6-8-17(13-16)22(23,24)25/h4-9,12-13,15,26H,3,14H2,1-2H3 |
| InChIKey | WVVVIDNTWRRVLA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|