C22H19ClF3N3O3 — CID 140678686
ethyl 2-[2-[3-[2-[4-chloro-3-(trifluoromethoxy)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]ethylamino]acetate (PubChem CID 140678686) has the molecular formula C22H19ClF3N3O3 and a molecular weight of 465.86 g/mol. Its IUPAC name is ethyl 2-[2-[3-[2-[4-chloro-3-(trifluoromethoxy)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]ethylamino]acetate.
| Compound Name | ethyl 2-[2-[3-[2-[4-chloro-3-(trifluoromethoxy)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]ethylamino]acetate |
|---|---|
| PubChem CID | 140678686 |
| Molecular Formula | C22H19ClF3N3O3 |
| Molecular Weight | 465.86 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | ethyl 2-[2-[3-[2-[4-chloro-3-(trifluoromethoxy)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]ethylamino]acetate |
| SMILES | CCOC(=O)CNCCc1nc2ccccn2c1C#Cc1ccc(Cl)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C22H19ClF3N3O3/c1-2-31-21(30)14-27-11-10-17-18(29-12-4-3-5-20(29)28-17)9-7-15-6-8-16(23)19(13-15)32-22(24,25)26/h3-6,8,12-13,27H,2,10-11,14H2,1H3 |
| InChIKey | UXGYFQQDYUPAMS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.86 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|