C21H17F3N2O2S — CID 73052291
ethyl 2-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methylsulfanyl]acetate (PubChem CID 73052291) has the molecular formula C21H17F3N2O2S and a molecular weight of 418.44 g/mol. Its IUPAC name is ethyl 2-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methylsulfanyl]acetate.
| Compound Name | ethyl 2-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 73052291 |
| Molecular Formula | C21H17F3N2O2S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | ethyl 2-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methylsulfanyl]acetate |
| SMILES | CCOC(=O)CSCc1nc2ccccn2c1C#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17F3N2O2S/c1-2-28-20(27)14-29-13-17-18(26-11-4-3-8-19(26)25-17)10-9-15-6-5-7-16(12-15)21(22,23)24/h3-8,11-12H,2,13-14H2,1H3 |
| InChIKey | TZYRUVZFUOSBAX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|