C25H17F3N2O3 — CID 122526199
3-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methoxymethyl]benzoic acid (PubChem CID 122526199) has the molecular formula C25H17F3N2O3 and a molecular weight of 450.42 g/mol. Its IUPAC name is 3-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methoxymethyl]benzoic acid.
| Compound Name | 3-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methoxymethyl]benzoic acid |
|---|---|
| PubChem CID | 122526199 |
| Molecular Formula | C25H17F3N2O3 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 3-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methoxymethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COCc2nc3ccccn3c2C#Cc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C25H17F3N2O3/c26-25(27,28)20-8-4-5-17(14-20)10-11-22-21(29-23-9-1-2-12-30(22)23)16-33-15-18-6-3-7-19(13-18)24(31)32/h1-9,12-14H,15-16H2,(H,31,32) |
| InChIKey | BVPWXRAZLBFWSO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|