C25H14F3N3O2 — CID 118195079
2-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methyl]isoindole-1,3-dione (PubChem CID 118195079) has the molecular formula C25H14F3N3O2 and a molecular weight of 445.40 g/mol. Its IUPAC name is 2-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118195079 |
| Molecular Formula | C25H14F3N3O2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 2-[[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]imidazo[1,2-a]pyridin-2-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1nc2ccccn2c1C#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H14F3N3O2/c26-25(27,28)17-7-5-6-16(14-17)11-12-21-20(29-22-10-3-4-13-30(21)22)15-31-23(32)18-8-1-2-9-19(18)24(31)33/h1-10,13-14H,15H2 |
| InChIKey | OBDMMWFPUGOPPK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|