C15H9ClN4O2 — CID 87508842
2-[(4-chloropyrrolo[1,2-a][1,3,5]triazin-2-yl)methyl]isoindole-1,3-dione (PubChem CID 87508842) has the molecular formula C15H9ClN4O2 and a molecular weight of 312.72 g/mol. Its IUPAC name is 2-[(4-chloropyrrolo[1,2-a][1,3,5]triazin-2-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(4-chloropyrrolo[1,2-a][1,3,5]triazin-2-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 87508842 |
| Molecular Formula | C15H9ClN4O2 |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-[(4-chloropyrrolo[1,2-a][1,3,5]triazin-2-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1nc(Cl)n2cccc2n1 |
| InChI | InChI=1S/C15H9ClN4O2/c16-15-18-11(17-12-6-3-7-19(12)15)8-20-13(21)9-4-1-2-5-10(9)14(20)22/h1-7H,8H2 |
| InChIKey | HDVPBJMPAGZJPB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|