C15H10ClN3O4 — CID 175184311
[4-chloro-6-[(1,3-dioxoisoindol-2-yl)methyl]-2-pyridinyl] carbamate (PubChem CID 175184311) has the molecular formula C15H10ClN3O4 and a molecular weight of 331.72 g/mol. Its IUPAC name is [4-chloro-6-[(1,3-dioxoisoindol-2-yl)methyl]-2-pyridinyl] carbamate.
| Compound Name | [4-chloro-6-[(1,3-dioxoisoindol-2-yl)methyl]-2-pyridinyl] carbamate |
|---|---|
| PubChem CID | 175184311 |
| Molecular Formula | C15H10ClN3O4 |
| Molecular Weight | 331.72 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | [4-chloro-6-[(1,3-dioxoisoindol-2-yl)methyl]-2-pyridinyl] carbamate |
| SMILES | NC(=O)Oc1cc(Cl)cc(CN2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C15H10ClN3O4/c16-8-5-9(18-12(6-8)23-15(17)22)7-19-13(20)10-3-1-2-4-11(10)14(19)21/h1-6H,7H2,(H2,17,22) |
| InChIKey | TXNUZVRQYCPTMQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.72 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|