C17H12ClFN2O4 — CID 122609536
ethyl 4-chloro-6-[(1,3-dioxoisoindol-2-yl)methyl]-3-fluoropyridine-2-carboxylate (PubChem CID 122609536) has the molecular formula C17H12ClFN2O4 and a molecular weight of 362.74 g/mol. Its IUPAC name is ethyl 4-chloro-6-[(1,3-dioxoisoindol-2-yl)methyl]-3-fluoropyridine-2-carboxylate.
| Compound Name | ethyl 4-chloro-6-[(1,3-dioxoisoindol-2-yl)methyl]-3-fluoropyridine-2-carboxylate |
|---|---|
| PubChem CID | 122609536 |
| Molecular Formula | C17H12ClFN2O4 |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | ethyl 4-chloro-6-[(1,3-dioxoisoindol-2-yl)methyl]-3-fluoropyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(CN2C(=O)c3ccccc3C2=O)cc(Cl)c1F |
| InChI | InChI=1S/C17H12ClFN2O4/c1-2-25-17(24)14-13(19)12(18)7-9(20-14)8-21-15(22)10-5-3-4-6-11(10)16(21)23/h3-7H,2,8H2,1H3 |
| InChIKey | OZGIFEUZCRTSRT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|