C18H13N2NaO3 — CID 73052926
sodium 2-[[3-(2-phenylethynyl)imidazo[1,2-a]pyridin-2-yl]methoxy]acetate (PubChem CID 73052926) has the molecular formula C18H13N2NaO3 and a molecular weight of 328.30 g/mol. Its IUPAC name is sodium 2-[[3-(2-phenylethynyl)imidazo[1,2-a]pyridin-2-yl]methoxy]acetate.
| Compound Name | sodium 2-[[3-(2-phenylethynyl)imidazo[1,2-a]pyridin-2-yl]methoxy]acetate |
|---|---|
| PubChem CID | 73052926 |
| Molecular Formula | C18H13N2NaO3 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | sodium 2-[[3-(2-phenylethynyl)imidazo[1,2-a]pyridin-2-yl]methoxy]acetate |
| SMILES | O=C([O-])COCc1nc2ccccn2c1C#Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C18H14N2O3.Na/c21-18(22)13-23-12-15-16(10-9-14-6-2-1-3-7-14)20-11-5-4-8-17(20)19-15;/h1-8,11H,12-13H2,(H,21,22);/q;+1/p-1 |
| InChIKey | OXPYLLQYLBLIJP-UHFFFAOYSA-M |
| XLogP | -2.00 |
| TPSA | 66.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|