C22H21FN2O3 — CID 122545975
tert-butyl 2-[[3-[2-(4-fluorophenyl)ethynyl]imidazo[1,2-a]pyridin-2-yl]methoxy]acetate (PubChem CID 122545975) has the molecular formula C22H21FN2O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is tert-butyl 2-[[3-[2-(4-fluorophenyl)ethynyl]imidazo[1,2-a]pyridin-2-yl]methoxy]acetate.
| Compound Name | tert-butyl 2-[[3-[2-(4-fluorophenyl)ethynyl]imidazo[1,2-a]pyridin-2-yl]methoxy]acetate |
|---|---|
| PubChem CID | 122545975 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | tert-butyl 2-[[3-[2-(4-fluorophenyl)ethynyl]imidazo[1,2-a]pyridin-2-yl]methoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCc1nc2ccccn2c1C#Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN2O3/c1-22(2,3)28-21(26)15-27-14-18-19(25-13-5-4-6-20(25)24-18)12-9-16-7-10-17(23)11-8-16/h4-8,10-11,13H,14-15H2,1-3H3 |
| InChIKey | NZVWCWWSYUHWAO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|