C16H12F9N3O2S — CID 123790336
1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-5-(nitrosomethyl)-3-(2,2,3,3,3-pentafluoropropoxy)pyrazole (PubChem CID 123790336) has the molecular formula C16H12F9N3O2S and a molecular weight of 481.34 g/mol. Its IUPAC name is 1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-5-(nitrosomethyl)-3-(2,2,3,3,3-pentafluoropropoxy)pyrazole.
| Compound Name | 1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-5-(nitrosomethyl)-3-(2,2,3,3,3-pentafluoropropoxy)pyrazole |
|---|---|
| PubChem CID | 123790336 |
| Molecular Formula | C16H12F9N3O2S |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | 1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-5-(nitrosomethyl)-3-(2,2,3,3,3-pentafluoropropoxy)pyrazole |
| SMILES | Cc1cc(F)c(-n2nc(OCC(F)(F)C(F)(F)F)cc2CN=O)cc1SCC(F)(F)F |
| InChI | InChI=1S/C16H12F9N3O2S/c1-8-2-10(17)11(4-12(8)31-7-15(20,21)22)28-9(5-26-29)3-13(27-28)30-6-14(18,19)16(23,24)25/h2-4H,5-7H2,1H3 |
| InChIKey | HBQCEINQCLJBBV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|