C36H60O5 — CID 123790990
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] icosa-3,13-dienoate (PubChem CID 123790990) has the molecular formula C36H60O5 and a molecular weight of 572.87 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] icosa-3,13-dienoate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] icosa-3,13-dienoate |
|---|---|
| PubChem CID | 123790990 |
| Molecular Formula | C36H60O5 |
| Molecular Weight | 572.87 g/mol |
| Exact Mass | 572.44 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] icosa-3,13-dienoate |
| SMILES | CCCCCCC=CCCCCCCCCC=CCC(=O)O[C@@H]1CC[C@]2(CO2)[C@@H]([C@@]2(C)O[C@@H]2CC=C(C)C)[C@@H]1OC |
| InChI | InChI=1S/C36H60O5/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-32(37)40-30-26-27-36(28-39-36)34(33(30)38-5)35(4)31(41-35)25-24-29(2)3/h11-12,21-22,24,30-31,33-34H,6-10,13-20,23,25-28H2,1-5H3/t30-,31-,33-,34-,35+,36+/m1/s1 |
| InChIKey | SLTYEPZEFPFFIU-HABVGYIUSA-N |
| XLogP | 9.20 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.87 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|