C23H39NO5 — CID 23547027
[5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(pentylamino)acetate (PubChem CID 23547027) has the molecular formula C23H39NO5 and a molecular weight of 409.57 g/mol. Its IUPAC name is [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(pentylamino)acetate.
| Compound Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(pentylamino)acetate |
|---|---|
| PubChem CID | 23547027 |
| Molecular Formula | C23H39NO5 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(pentylamino)acetate |
| SMILES | CCCCCNCC(=O)OC1CCC2(CO2)C(C2(C)OC2CC=C(C)C)C1OC |
| InChI | InChI=1S/C23H39NO5/c1-6-7-8-13-24-14-19(25)28-17-11-12-23(15-27-23)21(20(17)26-5)22(4)18(29-22)10-9-16(2)3/h9,17-18,20-21,24H,6-8,10-15H2,1-5H3 |
| InChIKey | JAODHEIYQGEGCS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|